C20H16N4O4S — CID 76566282
5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-thieno[3,2-c]pyridin-2-ylimidazolidine-2,4-dione (PubChem CID 76566282) has the molecular formula C20H16N4O4S and a molecular weight of 408.44 g/mol. Its IUPAC name is 5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-thieno[3,2-c]pyridin-2-ylimidazolidine-2,4-dione.
| Compound Name | 5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-thieno[3,2-c]pyridin-2-ylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 76566282 |
| Molecular Formula | C20H16N4O4S |
| Molecular Weight | 408.44 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | 5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-thieno[3,2-c]pyridin-2-ylimidazolidine-2,4-dione |
| SMILES | COc1ccc2c(c1)C(=O)N(CC1(c3cc4cnccc4s3)NC(=O)NC1=O)C2 |
| InChI | InChI=1S/C20H16N4O4S/c1-28-13-3-2-11-9-24(17(25)14(11)7-13)10-20(18(26)22-19(27)23-20)16-6-12-8-21-5-4-15(12)29-16/h2-8H,9-10H2,1H3,(H2,22,23,26,27) |
| InChIKey | STUHSIVLYFUVGP-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.44 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|