C20H23BrN2O3 — CID 76576776
6a-(3-bromophenyl)-5-[(2,4-dimethoxyphenyl)methyl]-3,3a,4,6-tetrahydro-1H-pyrrolo[3,4-c][1,2]oxazole (PubChem CID 76576776) has the molecular formula C20H23BrN2O3 and a molecular weight of 419.32 g/mol. Its IUPAC name is 6a-(3-bromophenyl)-5-[(2,4-dimethoxyphenyl)methyl]-3,3a,4,6-tetrahydro-1H-pyrrolo[3,4-c][1,2]oxazole.
| Compound Name | 6a-(3-bromophenyl)-5-[(2,4-dimethoxyphenyl)methyl]-3,3a,4,6-tetrahydro-1H-pyrrolo[3,4-c][1,2]oxazole |
|---|---|
| PubChem CID | 76576776 |
| Molecular Formula | C20H23BrN2O3 |
| Molecular Weight | 419.32 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | 6a-(3-bromophenyl)-5-[(2,4-dimethoxyphenyl)methyl]-3,3a,4,6-tetrahydro-1H-pyrrolo[3,4-c][1,2]oxazole |
| SMILES | COc1ccc(CN2CC3CONC3(c3cccc(Br)c3)C2)c(OC)c1 |
| InChI | InChI=1S/C20H23BrN2O3/c1-24-18-7-6-14(19(9-18)25-2)10-23-11-16-12-26-22-20(16,13-23)15-4-3-5-17(21)8-15/h3-9,16,22H,10-13H2,1-2H3 |
| InChIKey | CAKJLMKYDJTAEK-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.32 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |