C27H24BrClN4OS — CID 76593189
N-[4-[1-[3-(4-bromophenyl)prop-2-enyl]piperidin-4-yl]-1,3-benzothiazol-5-yl]-2-chloropyridine-4-carboxamide (PubChem CID 76593189) has the molecular formula C27H24BrClN4OS and a molecular weight of 567.94 g/mol. Its IUPAC name is N-[4-[1-[3-(4-bromophenyl)prop-2-enyl]piperidin-4-yl]-1,3-benzothiazol-5-yl]-2-chloropyridine-4-carboxamide.
| Compound Name | N-[4-[1-[3-(4-bromophenyl)prop-2-enyl]piperidin-4-yl]-1,3-benzothiazol-5-yl]-2-chloropyridine-4-carboxamide |
|---|---|
| PubChem CID | 76593189 |
| Molecular Formula | C27H24BrClN4OS |
| Molecular Weight | 567.94 g/mol |
| Exact Mass | 566.05 |
| IUPAC Name | N-[4-[1-[3-(4-bromophenyl)prop-2-enyl]piperidin-4-yl]-1,3-benzothiazol-5-yl]-2-chloropyridine-4-carboxamide |
| SMILES | O=C(Nc1ccc2scnc2c1C1CCN(CC=Cc2ccc(Br)cc2)CC1)c1ccnc(Cl)c1 |
| InChI | InChI=1S/C27H24BrClN4OS/c28-21-5-3-18(4-6-21)2-1-13-33-14-10-19(11-15-33)25-22(7-8-23-26(25)31-17-35-23)32-27(34)20-9-12-30-24(29)16-20/h1-9,12,16-17,19H,10-11,13-15H2,(H,32,34) |
| InChIKey | VPISYEUEQPGBGN-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.94 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|