C27H29Cl2N4O+ — CID 58201599
2-chloro-N-[2-[1-[(E)-3-(4-chlorophenyl)prop-2-enyl]-1-methylpiperidin-1-ium-4-yl]-6-methyl-3-pyridinyl]pyridine-4-carboxamide (PubChem CID 58201599) has the molecular formula C27H29Cl2N4O+ and a molecular weight of 496.46 g/mol. Its IUPAC name is 2-chloro-N-[2-[1-[(E)-3-(4-chlorophenyl)prop-2-enyl]-1-methylpiperidin-1-ium-4-yl]-6-methyl-3-pyridinyl]pyridine-4-carboxamide.
| Compound Name | 2-chloro-N-[2-[1-[(E)-3-(4-chlorophenyl)prop-2-enyl]-1-methylpiperidin-1-ium-4-yl]-6-methyl-3-pyridinyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 58201599 |
| Molecular Formula | C27H29Cl2N4O+ |
| Molecular Weight | 496.46 g/mol |
| Exact Mass | 495.17 |
| IUPAC Name | 2-chloro-N-[2-[1-[(E)-3-(4-chlorophenyl)prop-2-enyl]-1-methylpiperidin-1-ium-4-yl]-6-methyl-3-pyridinyl]pyridine-4-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2ccnc(Cl)c2)c(C2CC[N+](C)(C/C=C/c3ccc(Cl)cc3)CC2)n1 |
| InChI | InChI=1S/C27H28Cl2N4O/c1-19-5-10-24(32-27(34)22-11-14-30-25(29)18-22)26(31-19)21-12-16-33(2,17-13-21)15-3-4-20-6-8-23(28)9-7-20/h3-11,14,18,21H,12-13,15-17H2,1-2H3/p+1/b4-3+ |
| InChIKey | PAHDJLHCOFBIRV-ONEGZZNKSA-O |
| XLogP | 6.38 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.46 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|