C29H26Cl2N4O — CID 76593183
2-chloro-N-[8-[1-[3-(4-chlorophenyl)prop-2-enyl]piperidin-4-yl]quinolin-7-yl]pyridine-4-carboxamide (PubChem CID 76593183) has the molecular formula C29H26Cl2N4O and a molecular weight of 517.46 g/mol. Its IUPAC name is 2-chloro-N-[8-[1-[3-(4-chlorophenyl)prop-2-enyl]piperidin-4-yl]quinolin-7-yl]pyridine-4-carboxamide.
| Compound Name | 2-chloro-N-[8-[1-[3-(4-chlorophenyl)prop-2-enyl]piperidin-4-yl]quinolin-7-yl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 76593183 |
| Molecular Formula | C29H26Cl2N4O |
| Molecular Weight | 517.46 g/mol |
| Exact Mass | 516.15 |
| IUPAC Name | 2-chloro-N-[8-[1-[3-(4-chlorophenyl)prop-2-enyl]piperidin-4-yl]quinolin-7-yl]pyridine-4-carboxamide |
| SMILES | O=C(Nc1ccc2cccnc2c1C1CCN(CC=Cc2ccc(Cl)cc2)CC1)c1ccnc(Cl)c1 |
| InChI | InChI=1S/C29H26Cl2N4O/c30-24-8-5-20(6-9-24)3-2-16-35-17-12-21(13-18-35)27-25(10-7-22-4-1-14-33-28(22)27)34-29(36)23-11-15-32-26(31)19-23/h1-11,14-15,19,21H,12-13,16-18H2,(H,34,36) |
| InChIKey | CNFPZPKPIVOLKA-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.46 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|