C27H24Cl2F3N3O — CID 175554919
2-chloro-N-[2-[1-[(E)-3-(4-chlorophenyl)prop-1-enyl]piperidin-4-yl]-4-(trifluoromethyl)phenyl]pyridine-4-carboxamide (PubChem CID 175554919) has the molecular formula C27H24Cl2F3N3O and a molecular weight of 534.41 g/mol. Its IUPAC name is 2-chloro-N-[2-[1-[(E)-3-(4-chlorophenyl)prop-1-enyl]piperidin-4-yl]-4-(trifluoromethyl)phenyl]pyridine-4-carboxamide.
| Compound Name | 2-chloro-N-[2-[1-[(E)-3-(4-chlorophenyl)prop-1-enyl]piperidin-4-yl]-4-(trifluoromethyl)phenyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 175554919 |
| Molecular Formula | C27H24Cl2F3N3O |
| Molecular Weight | 534.41 g/mol |
| Exact Mass | 533.12 |
| IUPAC Name | 2-chloro-N-[2-[1-[(E)-3-(4-chlorophenyl)prop-1-enyl]piperidin-4-yl]-4-(trifluoromethyl)phenyl]pyridine-4-carboxamide |
| SMILES | O=C(Nc1ccc(C(F)(F)F)cc1C1CCN(/C=C/Cc2ccc(Cl)cc2)CC1)c1ccnc(Cl)c1 |
| InChI | InChI=1S/C27H24Cl2F3N3O/c28-22-6-3-18(4-7-22)2-1-13-35-14-10-19(11-15-35)23-17-21(27(30,31)32)5-8-24(23)34-26(36)20-9-12-33-25(29)16-20/h1,3-9,12-13,16-17,19H,2,10-11,14-15H2,(H,34,36)/b13-1+ |
| InChIKey | GJMNEQZVIKEOJO-HSIUAXRUSA-N |
| XLogP | 7.60 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.41 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|