C30H28Cl2F3N5O2 — CID 123925392
2-chloro-N-[2-[1-[2-[3-(5-chloropyrimidin-2-yl)prop-1-enyl]penta-2,4-dienyl]-1-oxidopiperidin-1-ium-4-yl]-4-(trifluoromethyl)phenyl]pyridine-4-carboxamide (PubChem CID 123925392) has the molecular formula C30H28Cl2F3N5O2 and a molecular weight of 618.49 g/mol. Its IUPAC name is 2-chloro-N-[2-[1-[2-[3-(5-chloropyrimidin-2-yl)prop-1-enyl]penta-2,4-dienyl]-1-oxidopiperidin-1-ium-4-yl]-4-(trifluoromethyl)phenyl]pyridine-4-carboxamide.
| Compound Name | 2-chloro-N-[2-[1-[2-[3-(5-chloropyrimidin-2-yl)prop-1-enyl]penta-2,4-dienyl]-1-oxidopiperidin-1-ium-4-yl]-4-(trifluoromethyl)phenyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 123925392 |
| Molecular Formula | C30H28Cl2F3N5O2 |
| Molecular Weight | 618.49 g/mol |
| Exact Mass | 617.16 |
| IUPAC Name | 2-chloro-N-[2-[1-[2-[3-(5-chloropyrimidin-2-yl)prop-1-enyl]penta-2,4-dienyl]-1-oxidopiperidin-1-ium-4-yl]-4-(trifluoromethyl)phenyl]pyridine-4-carboxamide |
| SMILES | C=CC=C(C=CCc1ncc(Cl)cn1)C[N+]1([O-])CCC(c2cc(C(F)(F)F)ccc2NC(=O)c2ccnc(Cl)c2)CC1 |
| InChI | InChI=1S/C30H28Cl2F3N5O2/c1-2-4-20(5-3-6-28-37-17-24(31)18-38-28)19-40(42)13-10-21(11-14-40)25-16-23(30(33,34)35)7-8-26(25)39-29(41)22-9-12-36-27(32)15-22/h2-5,7-9,12,15-18,21H,1,6,10-11,13-14,19H2,(H,39,41) |
| InChIKey | ZKVBDCKLGWCVPS-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 90.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.49 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|