C30H26ClF4N4O2+ — CID 88884842
2-chloro-N-[2-[1-[[4-(4-fluorophenyl)phenyl]methyl]-1-hydroxypiperidin-1-ium-4-yl]-6-(trifluoromethyl)-3-pyridinyl]pyridine-4-carboxamide (PubChem CID 88884842) has the molecular formula C30H26ClF4N4O2+ and a molecular weight of 586.01 g/mol. Its IUPAC name is 2-chloro-N-[2-[1-[[4-(4-fluorophenyl)phenyl]methyl]-1-hydroxypiperidin-1-ium-4-yl]-6-(trifluoromethyl)-3-pyridinyl]pyridine-4-carboxamide.
| Compound Name | 2-chloro-N-[2-[1-[[4-(4-fluorophenyl)phenyl]methyl]-1-hydroxypiperidin-1-ium-4-yl]-6-(trifluoromethyl)-3-pyridinyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 88884842 |
| Molecular Formula | C30H26ClF4N4O2+ |
| Molecular Weight | 586.01 g/mol |
| Exact Mass | 585.17 |
| IUPAC Name | 2-chloro-N-[2-[1-[[4-(4-fluorophenyl)phenyl]methyl]-1-hydroxypiperidin-1-ium-4-yl]-6-(trifluoromethyl)-3-pyridinyl]pyridine-4-carboxamide |
| SMILES | O=C(Nc1ccc(C(F)(F)F)nc1C1CC[N+](O)(Cc2ccc(-c3ccc(F)cc3)cc2)CC1)c1ccnc(Cl)c1 |
| InChI | InChI=1S/C30H25ClF4N4O2/c31-27-17-23(11-14-36-27)29(40)37-25-9-10-26(30(33,34)35)38-28(25)22-12-15-39(41,16-13-22)18-19-1-3-20(4-2-19)21-5-7-24(32)8-6-21/h1-11,14,17,22,41H,12-13,15-16,18H2/p+1 |
| InChIKey | MCXYDHKYNUJEHY-UHFFFAOYSA-O |
| XLogP | 7.49 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.01 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|