C8H13N3 — CID 76593341
N'-(1,2-dihydropyridin-2-yl)-N,N-dimethylmethanimidamide (PubChem CID 76593341) has the molecular formula C8H13N3 and a molecular weight of 151.21 g/mol. Its IUPAC name is N'-(1,2-dihydropyridin-2-yl)-N,N-dimethylmethanimidamide.
| Compound Name | N'-(1,2-dihydropyridin-2-yl)-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 76593341 |
| Molecular Formula | C8H13N3 |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.11 |
| IUPAC Name | N'-(1,2-dihydropyridin-2-yl)-N,N-dimethylmethanimidamide |
| SMILES | CN(C)C=NC1C=CC=CN1 |
| InChI | InChI=1S/C8H13N3/c1-11(2)7-10-8-5-3-4-6-9-8/h3-9H,1-2H3 |
| InChIKey | WSRMBBSEGUCFLS-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|