C9H13N4+ — CID 91490293
N-cyano-N'-(1,1-dimethyl-2H-pyridin-1-ium-6-yl)methanimidamide (PubChem CID 91490293) has the molecular formula C9H13N4+ and a molecular weight of 177.23 g/mol. Its IUPAC name is N-cyano-N'-(1,1-dimethyl-2H-pyridin-1-ium-6-yl)methanimidamide.
| Compound Name | N-cyano-N'-(1,1-dimethyl-2H-pyridin-1-ium-6-yl)methanimidamide |
|---|---|
| PubChem CID | 91490293 |
| Molecular Formula | C9H13N4+ |
| Molecular Weight | 177.23 g/mol |
| Exact Mass | 177.11 |
| IUPAC Name | N-cyano-N'-(1,1-dimethyl-2H-pyridin-1-ium-6-yl)methanimidamide |
| SMILES | C[N+]1(C)CC=CC=C1N=CNC#N |
| InChI | InChI=1S/C9H13N4/c1-13(2)6-4-3-5-9(13)12-8-11-7-10/h3-5,8H,6H2,1-2H3,(H,11,12)/q+1 |
| InChIKey | PGMNKNLJVPWMLR-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 48.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.23 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|