C10H15N4+ — CID 91608428
N-cyano-N'-(1,1,5-trimethyl-2H-pyridin-1-ium-6-yl)methanimidamide (PubChem CID 91608428) has the molecular formula C10H15N4+ and a molecular weight of 191.26 g/mol. Its IUPAC name is N-cyano-N'-(1,1,5-trimethyl-2H-pyridin-1-ium-6-yl)methanimidamide.
| Compound Name | N-cyano-N'-(1,1,5-trimethyl-2H-pyridin-1-ium-6-yl)methanimidamide |
|---|---|
| PubChem CID | 91608428 |
| Molecular Formula | C10H15N4+ |
| Molecular Weight | 191.26 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | N-cyano-N'-(1,1,5-trimethyl-2H-pyridin-1-ium-6-yl)methanimidamide |
| SMILES | CC1=C(N=CNC#N)[N+](C)(C)CC=C1 |
| InChI | InChI=1S/C10H15N4/c1-9-5-4-6-14(2,3)10(9)13-8-12-7-11/h4-5,8H,6H2,1-3H3,(H,12,13)/q+1 |
| InChIKey | IWDAGTHBLOKKPD-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 48.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.26 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|