C10H15N5 — CID 159034110
6-(cyclopenta-1,4-dien-1-ylmethylimino)-2-methyl-2,5-dihydro-1H-1,3,5-triazin-4-amine (PubChem CID 159034110) has the molecular formula C10H15N5 and a molecular weight of 205.26 g/mol. Its IUPAC name is 6-(cyclopenta-1,4-dien-1-ylmethylimino)-2-methyl-2,5-dihydro-1H-1,3,5-triazin-4-amine.
| Compound Name | 6-(cyclopenta-1,4-dien-1-ylmethylimino)-2-methyl-2,5-dihydro-1H-1,3,5-triazin-4-amine |
|---|---|
| PubChem CID | 159034110 |
| Molecular Formula | C10H15N5 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | 6-(cyclopenta-1,4-dien-1-ylmethylimino)-2-methyl-2,5-dihydro-1H-1,3,5-triazin-4-amine |
| SMILES | CC1N=C(N)N/C(=N\CC2=CCC=C2)N1 |
| InChI | InChI=1S/C10H15N5/c1-7-13-9(11)15-10(14-7)12-6-8-4-2-3-5-8/h2,4-5,7H,3,6H2,1H3,(H4,11,12,13,14,15) |
| InChIKey | NIVKBZCCWUXRSX-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 74.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|