C12H19N5 — CID 159034114
6-(cyclopenta-1,4-dien-1-ylmethylimino)-N,N,2-trimethyl-2,5-dihydro-1H-1,3,5-triazin-4-amine (PubChem CID 159034114) has the molecular formula C12H19N5 and a molecular weight of 233.32 g/mol. Its IUPAC name is 6-(cyclopenta-1,4-dien-1-ylmethylimino)-N,N,2-trimethyl-2,5-dihydro-1H-1,3,5-triazin-4-amine.
| Compound Name | 6-(cyclopenta-1,4-dien-1-ylmethylimino)-N,N,2-trimethyl-2,5-dihydro-1H-1,3,5-triazin-4-amine |
|---|---|
| PubChem CID | 159034114 |
| Molecular Formula | C12H19N5 |
| Molecular Weight | 233.32 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | 6-(cyclopenta-1,4-dien-1-ylmethylimino)-N,N,2-trimethyl-2,5-dihydro-1H-1,3,5-triazin-4-amine |
| SMILES | CC1N=C(N(C)C)N/C(=N\CC2=CCC=C2)N1 |
| InChI | InChI=1S/C12H19N5/c1-9-14-11(16-12(15-9)17(2)3)13-8-10-6-4-5-7-10/h4,6-7,9H,5,8H2,1-3H3,(H2,13,14,15,16) |
| InChIKey | OPETVEKLXYWQPY-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 52.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.32 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|