C9H15N5 — CID 158386966
1-(cyclopenta-1,4-dien-1-ylmethyl)-3-(diaminomethylidene)-2-methylguanidine (PubChem CID 158386966) has the molecular formula C9H15N5 and a molecular weight of 193.25 g/mol. Its IUPAC name is 1-(cyclopenta-1,4-dien-1-ylmethyl)-3-(diaminomethylidene)-2-methylguanidine.
| Compound Name | 1-(cyclopenta-1,4-dien-1-ylmethyl)-3-(diaminomethylidene)-2-methylguanidine |
|---|---|
| PubChem CID | 158386966 |
| Molecular Formula | C9H15N5 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.13 |
| IUPAC Name | 1-(cyclopenta-1,4-dien-1-ylmethyl)-3-(diaminomethylidene)-2-methylguanidine |
| SMILES | C/N=C(/N=C(N)N)NCC1=CCC=C1 |
| InChI | InChI=1S/C9H15N5/c1-12-9(14-8(10)11)13-6-7-4-2-3-5-7/h2,4-5H,3,6H2,1H3,(H5,10,11,12,13,14) |
| InChIKey | RPUGEVIAIAVRPR-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 88.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|