C13H12O3 — CID 76595416
1,5-bis(furan-2-yl)pent-1-en-3-one (PubChem CID 76595416) has the molecular formula C13H12O3 and a molecular weight of 216.24 g/mol. Its IUPAC name is 1,5-bis(furan-2-yl)pent-1-en-3-one.
| Compound Name | 1,5-bis(furan-2-yl)pent-1-en-3-one |
|---|---|
| PubChem CID | 76595416 |
| Molecular Formula | C13H12O3 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | 1,5-bis(furan-2-yl)pent-1-en-3-one |
| SMILES | O=C(C=Cc1ccco1)CCc1ccco1 |
| InChI | InChI=1S/C13H12O3/c14-11(5-7-12-3-1-9-15-12)6-8-13-4-2-10-16-13/h1-5,7,9-10H,6,8H2 |
| InChIKey | LKAGPPDHFOITET-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 43.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|