C26H19ClFN3O2 — CID 76599372
2-[1-[8-chloro-2-(2-ethyl-5-fluoro-3-pyridinyl)quinolin-3-yl]ethyl]isoindole-1,3-dione (PubChem CID 76599372) has the molecular formula C26H19ClFN3O2 and a molecular weight of 459.91 g/mol. Its IUPAC name is 2-[1-[8-chloro-2-(2-ethyl-5-fluoro-3-pyridinyl)quinolin-3-yl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[1-[8-chloro-2-(2-ethyl-5-fluoro-3-pyridinyl)quinolin-3-yl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 76599372 |
| Molecular Formula | C26H19ClFN3O2 |
| Molecular Weight | 459.91 g/mol |
| Exact Mass | 459.11 |
| IUPAC Name | 2-[1-[8-chloro-2-(2-ethyl-5-fluoro-3-pyridinyl)quinolin-3-yl]ethyl]isoindole-1,3-dione |
| SMILES | CCc1ncc(F)cc1-c1nc2c(Cl)cccc2cc1C(C)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C26H19ClFN3O2/c1-3-22-20(12-16(28)13-29-22)24-19(11-15-7-6-10-21(27)23(15)30-24)14(2)31-25(32)17-8-4-5-9-18(17)26(31)33/h4-14H,3H2,1-2H3 |
| InChIKey | MZRFYOOKPHWFLN-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.91 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|