C22H14ClN3O2S — CID 76599387
2-[1-[8-chloro-2-(1,3-thiazol-5-yl)quinolin-3-yl]ethyl]isoindole-1,3-dione (PubChem CID 76599387) has the molecular formula C22H14ClN3O2S and a molecular weight of 419.89 g/mol. Its IUPAC name is 2-[1-[8-chloro-2-(1,3-thiazol-5-yl)quinolin-3-yl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[1-[8-chloro-2-(1,3-thiazol-5-yl)quinolin-3-yl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 76599387 |
| Molecular Formula | C22H14ClN3O2S |
| Molecular Weight | 419.89 g/mol |
| Exact Mass | 419.05 |
| IUPAC Name | 2-[1-[8-chloro-2-(1,3-thiazol-5-yl)quinolin-3-yl]ethyl]isoindole-1,3-dione |
| SMILES | CC(c1cc2cccc(Cl)c2nc1-c1cncs1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C22H14ClN3O2S/c1-12(26-21(27)14-6-2-3-7-15(14)22(26)28)16-9-13-5-4-8-17(23)19(13)25-20(16)18-10-24-11-29-18/h2-12H,1H3 |
| InChIKey | VIZIAPJNXYFYRY-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.89 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|