C21H22N2O3 — CID 76606768
4-[4-(4-but-1-enyl-1,3-dimethylpyrazol-5-yl)oxyphenoxy]phenol (PubChem CID 76606768) has the molecular formula C21H22N2O3 and a molecular weight of 350.42 g/mol. Its IUPAC name is 4-[4-(4-but-1-enyl-1,3-dimethylpyrazol-5-yl)oxyphenoxy]phenol.
| Compound Name | 4-[4-(4-but-1-enyl-1,3-dimethylpyrazol-5-yl)oxyphenoxy]phenol |
|---|---|
| PubChem CID | 76606768 |
| Molecular Formula | C21H22N2O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | 4-[4-(4-but-1-enyl-1,3-dimethylpyrazol-5-yl)oxyphenoxy]phenol |
| SMILES | CCC=Cc1c(C)nn(C)c1Oc1ccc(Oc2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C21H22N2O3/c1-4-5-6-20-15(2)22-23(3)21(20)26-19-13-11-18(12-14-19)25-17-9-7-16(24)8-10-17/h5-14,24H,4H2,1-3H3 |
| InChIKey | URBXGPWGYXUIPM-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |