C23H26N2O3 — CID 90881221
1,3,4-trimethyl-5-[4-[4-(3-methylbut-2-enoxy)phenoxy]phenoxy]pyrazole (PubChem CID 90881221) has the molecular formula C23H26N2O3 and a molecular weight of 378.47 g/mol. Its IUPAC name is 1,3,4-trimethyl-5-[4-[4-(3-methylbut-2-enoxy)phenoxy]phenoxy]pyrazole.
| Compound Name | 1,3,4-trimethyl-5-[4-[4-(3-methylbut-2-enoxy)phenoxy]phenoxy]pyrazole |
|---|---|
| PubChem CID | 90881221 |
| Molecular Formula | C23H26N2O3 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | 1,3,4-trimethyl-5-[4-[4-(3-methylbut-2-enoxy)phenoxy]phenoxy]pyrazole |
| SMILES | CC(C)=CCOc1ccc(Oc2ccc(Oc3c(C)c(C)nn3C)cc2)cc1 |
| InChI | InChI=1S/C23H26N2O3/c1-16(2)14-15-26-19-6-8-20(9-7-19)27-21-10-12-22(13-11-21)28-23-17(3)18(4)24-25(23)5/h6-14H,15H2,1-5H3 |
| InChIKey | BUKPSDFILLNYBS-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 45.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|