C23H20Cl2N4O4 — CID 91205481
2-[[5-[4-[4-(3,3-dichloroprop-2-enoxy)phenoxy]phenoxy]-1,3-dimethylpyrazol-4-yl]methylideneamino]oxyacetonitrile (PubChem CID 91205481) has the molecular formula C23H20Cl2N4O4 and a molecular weight of 487.34 g/mol. Its IUPAC name is 2-[[5-[4-[4-(3,3-dichloroprop-2-enoxy)phenoxy]phenoxy]-1,3-dimethylpyrazol-4-yl]methylideneamino]oxyacetonitrile.
| Compound Name | 2-[[5-[4-[4-(3,3-dichloroprop-2-enoxy)phenoxy]phenoxy]-1,3-dimethylpyrazol-4-yl]methylideneamino]oxyacetonitrile |
|---|---|
| PubChem CID | 91205481 |
| Molecular Formula | C23H20Cl2N4O4 |
| Molecular Weight | 487.34 g/mol |
| Exact Mass | 486.09 |
| IUPAC Name | 2-[[5-[4-[4-(3,3-dichloroprop-2-enoxy)phenoxy]phenoxy]-1,3-dimethylpyrazol-4-yl]methylideneamino]oxyacetonitrile |
| SMILES | Cc1nn(C)c(Oc2ccc(Oc3ccc(OCC=C(Cl)Cl)cc3)cc2)c1C=NOCC#N |
| InChI | InChI=1S/C23H20Cl2N4O4/c1-16-21(15-27-31-14-12-26)23(29(2)28-16)33-20-9-7-19(8-10-20)32-18-5-3-17(4-6-18)30-13-11-22(24)25/h3-11,15H,13-14H2,1-2H3 |
| InChIKey | MKEUWBYITXSQKV-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 90.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.34 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|