C21H24FN3O2 — CID 88527658
N-(6,6-dimethylhept-2-en-4-ynoxy)-1-[5-(3-fluorophenoxy)-1,3-dimethylpyrazol-4-yl]methanimine (PubChem CID 88527658) has the molecular formula C21H24FN3O2 and a molecular weight of 369.44 g/mol. Its IUPAC name is N-(6,6-dimethylhept-2-en-4-ynoxy)-1-[5-(3-fluorophenoxy)-1,3-dimethylpyrazol-4-yl]methanimine.
| Compound Name | N-(6,6-dimethylhept-2-en-4-ynoxy)-1-[5-(3-fluorophenoxy)-1,3-dimethylpyrazol-4-yl]methanimine |
|---|---|
| PubChem CID | 88527658 |
| Molecular Formula | C21H24FN3O2 |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | N-(6,6-dimethylhept-2-en-4-ynoxy)-1-[5-(3-fluorophenoxy)-1,3-dimethylpyrazol-4-yl]methanimine |
| SMILES | Cc1nn(C)c(Oc2cccc(F)c2)c1C=NOCC=CC#CC(C)(C)C |
| InChI | InChI=1S/C21H24FN3O2/c1-16-19(15-23-26-13-8-6-7-12-21(2,3)4)20(25(5)24-16)27-18-11-9-10-17(22)14-18/h6,8-11,14-15H,13H2,1-5H3 |
| InChIKey | YHAXCBFFKGFFSL-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 48.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|