C18H14ClFN4O3 — CID 172930058
[(E)-[5-(3-fluorophenoxy)-1,3-dimethylpyrazol-4-yl]methylideneamino] 2-chloropyridine-3-carboxylate (PubChem CID 172930058) has the molecular formula C18H14ClFN4O3 and a molecular weight of 388.79 g/mol. Its IUPAC name is [(E)-[5-(3-fluorophenoxy)-1,3-dimethylpyrazol-4-yl]methylideneamino] 2-chloropyridine-3-carboxylate.
| Compound Name | [(E)-[5-(3-fluorophenoxy)-1,3-dimethylpyrazol-4-yl]methylideneamino] 2-chloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 172930058 |
| Molecular Formula | C18H14ClFN4O3 |
| Molecular Weight | 388.79 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | [(E)-[5-(3-fluorophenoxy)-1,3-dimethylpyrazol-4-yl]methylideneamino] 2-chloropyridine-3-carboxylate |
| SMILES | Cc1nn(C)c(Oc2cccc(F)c2)c1/C=N/OC(=O)c1cccnc1Cl |
| InChI | InChI=1S/C18H14ClFN4O3/c1-11-15(10-22-27-18(25)14-7-4-8-21-16(14)19)17(24(2)23-11)26-13-6-3-5-12(20)9-13/h3-10H,1-2H3/b22-10+ |
| InChIKey | XMIAWOQJNFUJKG-LSHDLFTRSA-N |
| XLogP | 3.90 |
| TPSA | 78.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.79 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|