C24H25Cl2N3O4 — CID 91278900
1-[5-[4-[4-(3,3-dichloroprop-2-enoxy)phenoxy]phenoxy]-1,3-dimethylpyrazol-4-yl]-N-propan-2-yloxymethanimine (PubChem CID 91278900) has the molecular formula C24H25Cl2N3O4 and a molecular weight of 490.39 g/mol. Its IUPAC name is 1-[5-[4-[4-(3,3-dichloroprop-2-enoxy)phenoxy]phenoxy]-1,3-dimethylpyrazol-4-yl]-N-propan-2-yloxymethanimine.
| Compound Name | 1-[5-[4-[4-(3,3-dichloroprop-2-enoxy)phenoxy]phenoxy]-1,3-dimethylpyrazol-4-yl]-N-propan-2-yloxymethanimine |
|---|---|
| PubChem CID | 91278900 |
| Molecular Formula | C24H25Cl2N3O4 |
| Molecular Weight | 490.39 g/mol |
| Exact Mass | 489.12 |
| IUPAC Name | 1-[5-[4-[4-(3,3-dichloroprop-2-enoxy)phenoxy]phenoxy]-1,3-dimethylpyrazol-4-yl]-N-propan-2-yloxymethanimine |
| SMILES | Cc1nn(C)c(Oc2ccc(Oc3ccc(OCC=C(Cl)Cl)cc3)cc2)c1C=NOC(C)C |
| InChI | InChI=1S/C24H25Cl2N3O4/c1-16(2)33-27-15-22-17(3)28-29(4)24(22)32-21-11-9-20(10-12-21)31-19-7-5-18(6-8-19)30-14-13-23(25)26/h5-13,15-16H,14H2,1-4H3 |
| InChIKey | QAMXBHGYSCLKTC-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 67.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.39 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|