C22H25Cl2NO4 — CID 139900552
2-[4-[4-(3,3-dichloroprop-2-enoxy)phenoxy]phenoxy]-N-[(2-methylpropan-2-yl)oxy]propan-1-imine (PubChem CID 139900552) has the molecular formula C22H25Cl2NO4 and a molecular weight of 438.35 g/mol. Its IUPAC name is 2-[4-[4-(3,3-dichloroprop-2-enoxy)phenoxy]phenoxy]-N-[(2-methylpropan-2-yl)oxy]propan-1-imine.
| Compound Name | 2-[4-[4-(3,3-dichloroprop-2-enoxy)phenoxy]phenoxy]-N-[(2-methylpropan-2-yl)oxy]propan-1-imine |
|---|---|
| PubChem CID | 139900552 |
| Molecular Formula | C22H25Cl2NO4 |
| Molecular Weight | 438.35 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | 2-[4-[4-(3,3-dichloroprop-2-enoxy)phenoxy]phenoxy]-N-[(2-methylpropan-2-yl)oxy]propan-1-imine |
| SMILES | CC(C=NOC(C)(C)C)Oc1ccc(Oc2ccc(OCC=C(Cl)Cl)cc2)cc1 |
| InChI | InChI=1S/C22H25Cl2NO4/c1-16(15-25-29-22(2,3)4)27-18-9-11-20(12-10-18)28-19-7-5-17(6-8-19)26-14-13-21(23)24/h5-13,15-16H,14H2,1-4H3 |
| InChIKey | QEZYHKLJEZAYBS-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 49.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.35 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|