C23H25Cl2NO3 — CID 139900584
6-[4-(3,3-dichloroprop-2-enoxy)phenoxy]-N-[(2-methylpropan-2-yl)oxy]-3,4-dihydro-2H-naphthalen-1-imine (PubChem CID 139900584) has the molecular formula C23H25Cl2NO3 and a molecular weight of 434.36 g/mol. Its IUPAC name is 6-[4-(3,3-dichloroprop-2-enoxy)phenoxy]-N-[(2-methylpropan-2-yl)oxy]-3,4-dihydro-2H-naphthalen-1-imine.
| Compound Name | 6-[4-(3,3-dichloroprop-2-enoxy)phenoxy]-N-[(2-methylpropan-2-yl)oxy]-3,4-dihydro-2H-naphthalen-1-imine |
|---|---|
| PubChem CID | 139900584 |
| Molecular Formula | C23H25Cl2NO3 |
| Molecular Weight | 434.36 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | 6-[4-(3,3-dichloroprop-2-enoxy)phenoxy]-N-[(2-methylpropan-2-yl)oxy]-3,4-dihydro-2H-naphthalen-1-imine |
| SMILES | CC(C)(C)ON=C1CCCc2cc(Oc3ccc(OCC=C(Cl)Cl)cc3)ccc21 |
| InChI | InChI=1S/C23H25Cl2NO3/c1-23(2,3)29-26-21-6-4-5-16-15-19(11-12-20(16)21)28-18-9-7-17(8-10-18)27-14-13-22(24)25/h7-13,15H,4-6,14H2,1-3H3 |
| InChIKey | WTCZHEJREMGZDN-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.36 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|