C23H27Cl2NO3 — CID 139900475
4-[4-[4-(3,3-dichloroprop-2-enoxy)phenoxy]phenyl]-N-[(2-methylpropan-2-yl)oxy]butan-2-imine (PubChem CID 139900475) has the molecular formula C23H27Cl2NO3 and a molecular weight of 436.38 g/mol. Its IUPAC name is 4-[4-[4-(3,3-dichloroprop-2-enoxy)phenoxy]phenyl]-N-[(2-methylpropan-2-yl)oxy]butan-2-imine.
| Compound Name | 4-[4-[4-(3,3-dichloroprop-2-enoxy)phenoxy]phenyl]-N-[(2-methylpropan-2-yl)oxy]butan-2-imine |
|---|---|
| PubChem CID | 139900475 |
| Molecular Formula | C23H27Cl2NO3 |
| Molecular Weight | 436.38 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | 4-[4-[4-(3,3-dichloroprop-2-enoxy)phenoxy]phenyl]-N-[(2-methylpropan-2-yl)oxy]butan-2-imine |
| SMILES | CC(CCc1ccc(Oc2ccc(OCC=C(Cl)Cl)cc2)cc1)=NOC(C)(C)C |
| InChI | InChI=1S/C23H27Cl2NO3/c1-17(26-29-23(2,3)4)5-6-18-7-9-20(10-8-18)28-21-13-11-19(12-14-21)27-16-15-22(24)25/h7-15H,5-6,16H2,1-4H3 |
| InChIKey | IEPHEXMGDJENHV-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.38 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|