C22H25Cl2NO4 — CID 139900522
N-butan-2-yloxy-1-[4-[4-(3,3-dichloroprop-2-enoxy)phenoxy]phenoxy]propan-2-imine (PubChem CID 139900522) has the molecular formula C22H25Cl2NO4 and a molecular weight of 438.35 g/mol. Its IUPAC name is N-butan-2-yloxy-1-[4-[4-(3,3-dichloroprop-2-enoxy)phenoxy]phenoxy]propan-2-imine.
| Compound Name | N-butan-2-yloxy-1-[4-[4-(3,3-dichloroprop-2-enoxy)phenoxy]phenoxy]propan-2-imine |
|---|---|
| PubChem CID | 139900522 |
| Molecular Formula | C22H25Cl2NO4 |
| Molecular Weight | 438.35 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | N-butan-2-yloxy-1-[4-[4-(3,3-dichloroprop-2-enoxy)phenoxy]phenoxy]propan-2-imine |
| SMILES | CCC(C)ON=C(C)COc1ccc(Oc2ccc(OCC=C(Cl)Cl)cc2)cc1 |
| InChI | InChI=1S/C22H25Cl2NO4/c1-4-17(3)29-25-16(2)15-27-19-7-11-21(12-8-19)28-20-9-5-18(6-10-20)26-14-13-22(23)24/h5-13,17H,4,14-15H2,1-3H3 |
| InChIKey | UZSDZQCGUUHYKB-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 49.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.35 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|