C23H28Cl2N2O3 — CID 139900407
4-[4-(3,3-dichloroprop-2-enoxy)phenoxy]-N-(2-ethoxyimino-3,3-dimethylbutyl)aniline (PubChem CID 139900407) has the molecular formula C23H28Cl2N2O3 and a molecular weight of 451.39 g/mol. Its IUPAC name is 4-[4-(3,3-dichloroprop-2-enoxy)phenoxy]-N-(2-ethoxyimino-3,3-dimethylbutyl)aniline.
| Compound Name | 4-[4-(3,3-dichloroprop-2-enoxy)phenoxy]-N-(2-ethoxyimino-3,3-dimethylbutyl)aniline |
|---|---|
| PubChem CID | 139900407 |
| Molecular Formula | C23H28Cl2N2O3 |
| Molecular Weight | 451.39 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | 4-[4-(3,3-dichloroprop-2-enoxy)phenoxy]-N-(2-ethoxyimino-3,3-dimethylbutyl)aniline |
| SMILES | CCON=C(CNc1ccc(Oc2ccc(OCC=C(Cl)Cl)cc2)cc1)C(C)(C)C |
| InChI | InChI=1S/C23H28Cl2N2O3/c1-5-29-27-21(23(2,3)4)16-26-17-6-8-19(9-7-17)30-20-12-10-18(11-13-20)28-15-14-22(24)25/h6-14,26H,5,15-16H2,1-4H3 |
| InChIKey | PSEMIZLIZLJLIX-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 52.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.39 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|