C64H69N5O2S — CID 76609746
3-[7-[[5-[4-[bis(9,9-dibutylfluoren-2-yl)amino]phenyl]thiophen-2-yl]methylidene]-6-tert-butylpyrazolo[5,1-c][1,2,4]triazol-3-yl]prop-2-enoic acid (PubChem CID 76609746) has the molecular formula C64H69N5O2S and a molecular weight of 972.36 g/mol. Its IUPAC name is 3-[7-[[5-[4-[bis(9,9-dibutylfluoren-2-yl)amino]phenyl]thiophen-2-yl]methylidene]-6-tert-butylpyrazolo[5,1-c][1,2,4]triazol-3-yl]prop-2-enoic acid.
| Compound Name | 3-[7-[[5-[4-[bis(9,9-dibutylfluoren-2-yl)amino]phenyl]thiophen-2-yl]methylidene]-6-tert-butylpyrazolo[5,1-c][1,2,4]triazol-3-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 76609746 |
| Molecular Formula | C64H69N5O2S |
| Molecular Weight | 972.36 g/mol |
| Exact Mass | 971.52 |
| IUPAC Name | 3-[7-[[5-[4-[bis(9,9-dibutylfluoren-2-yl)amino]phenyl]thiophen-2-yl]methylidene]-6-tert-butylpyrazolo[5,1-c][1,2,4]triazol-3-yl]prop-2-enoic acid |
| SMILES | CCCCC1(CCCC)c2ccccc2-c2ccc(N(c3ccc(-c4ccc(C=c5c(C(C)(C)C)nn6c(C=CC(=O)O)nnc56)s4)cc3)c3ccc4c(c3)C(CCCC)(CCCC)c3ccccc3-4)cc21 |
| InChI | InChI=1S/C64H69N5O2S/c1-8-12-36-63(37-13-9-2)53-22-18-16-20-48(53)50-31-28-45(40-55(50)63)68(46-29-32-51-49-21-17-19-23-54(49)64(38-14-10-3,39-15-11-4)56(51)41-46)44-26-24-43(25-27-44)57-33-30-47(72-57)42-52-60(62(5,6)7)67-69-58(34-35-59(70)71)65-66-61(52)69/h16-35,40-42H,8-15,36-39H2,1-7H3,(H,70,71) |
| InChIKey | RJEYLKXHLYKEHI-UHFFFAOYSA-N |
| XLogP | 16.56 |
| TPSA | 83.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 972.36 |
| LogP ≤ 5 | 16.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|