C10H8BrF2NO3 — CID 76610876
3-(4-bromo-2,3-difluorophenyl)-5-(hydroxymethyl)-1,3-oxazolidin-2-one (PubChem CID 76610876) has the molecular formula C10H8BrF2NO3 and a molecular weight of 308.08 g/mol. Its IUPAC name is 3-(4-bromo-2,3-difluorophenyl)-5-(hydroxymethyl)-1,3-oxazolidin-2-one.
| Compound Name | 3-(4-bromo-2,3-difluorophenyl)-5-(hydroxymethyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 76610876 |
| Molecular Formula | C10H8BrF2NO3 |
| Molecular Weight | 308.08 g/mol |
| Exact Mass | 306.97 |
| IUPAC Name | 3-(4-bromo-2,3-difluorophenyl)-5-(hydroxymethyl)-1,3-oxazolidin-2-one |
| SMILES | O=C1OC(CO)CN1c1ccc(Br)c(F)c1F |
| InChI | InChI=1S/C10H8BrF2NO3/c11-6-1-2-7(9(13)8(6)12)14-3-5(4-15)17-10(14)16/h1-2,5,15H,3-4H2 |
| InChIKey | NVJLJAGITXTQQB-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.08 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|