C10H8F2INO3 — CID 71030094
3-(2,3-difluoro-4-iodophenyl)-5-(hydroxymethyl)-1,3-oxazolidin-2-one (PubChem CID 71030094) has the molecular formula C10H8F2INO3 and a molecular weight of 355.08 g/mol. Its IUPAC name is 3-(2,3-difluoro-4-iodophenyl)-5-(hydroxymethyl)-1,3-oxazolidin-2-one.
| Compound Name | 3-(2,3-difluoro-4-iodophenyl)-5-(hydroxymethyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 71030094 |
| Molecular Formula | C10H8F2INO3 |
| Molecular Weight | 355.08 g/mol |
| Exact Mass | 354.95 |
| IUPAC Name | 3-(2,3-difluoro-4-iodophenyl)-5-(hydroxymethyl)-1,3-oxazolidin-2-one |
| SMILES | O=C1OC(CO)CN1c1ccc(I)c(F)c1F |
| InChI | InChI=1S/C10H8F2INO3/c11-8-6(13)1-2-7(9(8)12)14-3-5(4-15)17-10(14)16/h1-2,5,15H,3-4H2 |
| InChIKey | UCDPNYCDZLQINL-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.08 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|