C21H21N3O3S — CID 76627193
3-[4-[(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)oxy]phenyl]-4-oxothieno[3,2-d]pyrimidine-6-carbaldehyde (PubChem CID 76627193) has the molecular formula C21H21N3O3S and a molecular weight of 395.48 g/mol. Its IUPAC name is 3-[4-[(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)oxy]phenyl]-4-oxothieno[3,2-d]pyrimidine-6-carbaldehyde.
| Compound Name | 3-[4-[(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)oxy]phenyl]-4-oxothieno[3,2-d]pyrimidine-6-carbaldehyde |
|---|---|
| PubChem CID | 76627193 |
| Molecular Formula | C21H21N3O3S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | 3-[4-[(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)oxy]phenyl]-4-oxothieno[3,2-d]pyrimidine-6-carbaldehyde |
| SMILES | CN1C2CCC1CC(Oc1ccc(-n3cnc4cc(C=O)sc4c3=O)cc1)C2 |
| InChI | InChI=1S/C21H21N3O3S/c1-23-14-2-3-15(23)9-17(8-14)27-16-6-4-13(5-7-16)24-12-22-19-10-18(11-25)28-20(19)21(24)26/h4-7,10-12,14-15,17H,2-3,8-9H2,1H3 |
| InChIKey | SKEZGCDHXPBWNC-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|