C33H39F2N2O6S+ — CID 76637338
6-[2-[6-(N-acetylanilino)hexa-1,3,5-trienyl]-5,7-difluoro-3-methyl-3-(4-sulfobutyl)indol-1-ium-1-yl]hexanoic acid (PubChem CID 76637338) has the molecular formula C33H39F2N2O6S+ and a molecular weight of 629.75 g/mol. Its IUPAC name is 6-[2-[6-(N-acetylanilino)hexa-1,3,5-trienyl]-5,7-difluoro-3-methyl-3-(4-sulfobutyl)indol-1-ium-1-yl]hexanoic acid.
| Compound Name | 6-[2-[6-(N-acetylanilino)hexa-1,3,5-trienyl]-5,7-difluoro-3-methyl-3-(4-sulfobutyl)indol-1-ium-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 76637338 |
| Molecular Formula | C33H39F2N2O6S+ |
| Molecular Weight | 629.75 g/mol |
| Exact Mass | 629.25 |
| IUPAC Name | 6-[2-[6-(N-acetylanilino)hexa-1,3,5-trienyl]-5,7-difluoro-3-methyl-3-(4-sulfobutyl)indol-1-ium-1-yl]hexanoic acid |
| SMILES | CC(=O)N(C=CC=CC=CC1=[N+](CCCCCC(=O)O)c2c(F)cc(F)cc2C1(C)CCCCS(=O)(=O)O)c1ccccc1 |
| InChI | InChI=1S/C33H38F2N2O6S/c1-25(38)36(27-15-7-5-8-16-27)20-12-4-3-9-17-30-33(2,19-11-14-22-44(41,42)43)28-23-26(34)24-29(35)32(28)37(30)21-13-6-10-18-31(39)40/h3-5,7-9,12,15-17,20,23-24H,6,10-11,13-14,18-19,21-22H2,1-2H3,(H-,39,40,41,42,43)/p+1 |
| InChIKey | NJPNNUKWLYCECK-UHFFFAOYSA-O |
| XLogP | 6.70 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.75 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|