C18H24N2O3 — CID 76639118
[4-[(3-acetamido-8-azabicyclo[3.2.1]octan-8-yl)methyl]phenyl] acetate (PubChem CID 76639118) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is [4-[(3-acetamido-8-azabicyclo[3.2.1]octan-8-yl)methyl]phenyl] acetate.
| Compound Name | [4-[(3-acetamido-8-azabicyclo[3.2.1]octan-8-yl)methyl]phenyl] acetate |
|---|---|
| PubChem CID | 76639118 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | [4-[(3-acetamido-8-azabicyclo[3.2.1]octan-8-yl)methyl]phenyl] acetate |
| SMILES | CC(=O)NC1CC2CCC(C1)N2Cc1ccc(OC(C)=O)cc1 |
| InChI | InChI=1S/C18H24N2O3/c1-12(21)19-15-9-16-5-6-17(10-15)20(16)11-14-3-7-18(8-4-14)23-13(2)22/h3-4,7-8,15-17H,5-6,9-11H2,1-2H3,(H,19,21) |
| InChIKey | UZPIAUFPBNFOHZ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|