C23H22N2O3 — CID 76640939
5-isocyano-7-methyl-2-[4-[3-(oxan-2-yloxy)prop-1-enyl]phenyl]-1,3-benzoxazole (PubChem CID 76640939) has the molecular formula C23H22N2O3 and a molecular weight of 374.44 g/mol. Its IUPAC name is 5-isocyano-7-methyl-2-[4-[3-(oxan-2-yloxy)prop-1-enyl]phenyl]-1,3-benzoxazole.
| Compound Name | 5-isocyano-7-methyl-2-[4-[3-(oxan-2-yloxy)prop-1-enyl]phenyl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 76640939 |
| Molecular Formula | C23H22N2O3 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | 5-isocyano-7-methyl-2-[4-[3-(oxan-2-yloxy)prop-1-enyl]phenyl]-1,3-benzoxazole |
| SMILES | [C-]#[N+]c1cc(C)c2oc(-c3ccc(C=CCOC4CCCCO4)cc3)nc2c1 |
| InChI | InChI=1S/C23H22N2O3/c1-16-14-19(24-2)15-20-22(16)28-23(25-20)18-10-8-17(9-11-18)6-5-13-27-21-7-3-4-12-26-21/h5-6,8-11,14-15,21H,3-4,7,12-13H2,1H3 |
| InChIKey | IDHGACTUZYRDHN-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 48.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|