C12H10ClF3N2O3 — CID 76653723
methyl 2-(2-chloro-N-(1,1,1-trifluoropropan-2-ylideneamino)anilino)-2-oxoacetate (PubChem CID 76653723) has the molecular formula C12H10ClF3N2O3 and a molecular weight of 322.67 g/mol. Its IUPAC name is methyl 2-(2-chloro-N-(1,1,1-trifluoropropan-2-ylideneamino)anilino)-2-oxoacetate.
| Compound Name | methyl 2-(2-chloro-N-(1,1,1-trifluoropropan-2-ylideneamino)anilino)-2-oxoacetate |
|---|---|
| PubChem CID | 76653723 |
| Molecular Formula | C12H10ClF3N2O3 |
| Molecular Weight | 322.67 g/mol |
| Exact Mass | 322.03 |
| IUPAC Name | methyl 2-(2-chloro-N-(1,1,1-trifluoropropan-2-ylideneamino)anilino)-2-oxoacetate |
| SMILES | COC(=O)C(=O)N(N=C(C)C(F)(F)F)c1ccccc1Cl |
| InChI | InChI=1S/C12H10ClF3N2O3/c1-7(12(14,15)16)17-18(10(19)11(20)21-2)9-6-4-3-5-8(9)13/h3-6H,1-2H3 |
| InChIKey | BDQNYJQACRFDMO-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.67 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|