C24H20F3N5O2 — CID 76656992
4-[8-(2,6-difluorophenyl)-4-(4-fluoro-2-methylphenyl)-7-oxopyrido[2,3-d]pyrimidin-2-yl]-N'-hydroxybutanimidamide (PubChem CID 76656992) has the molecular formula C24H20F3N5O2 and a molecular weight of 467.45 g/mol. Its IUPAC name is 4-[8-(2,6-difluorophenyl)-4-(4-fluoro-2-methylphenyl)-7-oxopyrido[2,3-d]pyrimidin-2-yl]-N'-hydroxybutanimidamide.
| Compound Name | 4-[8-(2,6-difluorophenyl)-4-(4-fluoro-2-methylphenyl)-7-oxopyrido[2,3-d]pyrimidin-2-yl]-N'-hydroxybutanimidamide |
|---|---|
| PubChem CID | 76656992 |
| Molecular Formula | C24H20F3N5O2 |
| Molecular Weight | 467.45 g/mol |
| Exact Mass | 467.16 |
| IUPAC Name | 4-[8-(2,6-difluorophenyl)-4-(4-fluoro-2-methylphenyl)-7-oxopyrido[2,3-d]pyrimidin-2-yl]-N'-hydroxybutanimidamide |
| SMILES | Cc1cc(F)ccc1-c1nc(CCCC(N)=NO)nc2c1ccc(=O)n2-c1c(F)cccc1F |
| InChI | InChI=1S/C24H20F3N5O2/c1-13-12-14(25)8-9-15(13)22-16-10-11-21(33)32(23-17(26)4-2-5-18(23)27)24(16)30-20(29-22)7-3-6-19(28)31-34/h2,4-5,8-12,34H,3,6-7H2,1H3,(H2,28,31) |
| InChIKey | LBEMNSSBTSTSDT-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 106.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.45 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|