C38H29F7O — CID 76660570
5-[1,1-difluoro-3-[4-[2-fluoro-4-[2-fluoro-4-(4-pentylphenyl)phenyl]phenyl]phenyl]prop-2-enoxy]-1,2,3-trifluorobenzene (PubChem CID 76660570) has the molecular formula C38H29F7O and a molecular weight of 634.64 g/mol. Its IUPAC name is 5-[1,1-difluoro-3-[4-[2-fluoro-4-[2-fluoro-4-(4-pentylphenyl)phenyl]phenyl]phenyl]prop-2-enoxy]-1,2,3-trifluorobenzene.
| Compound Name | 5-[1,1-difluoro-3-[4-[2-fluoro-4-[2-fluoro-4-(4-pentylphenyl)phenyl]phenyl]phenyl]prop-2-enoxy]-1,2,3-trifluorobenzene |
|---|---|
| PubChem CID | 76660570 |
| Molecular Formula | C38H29F7O |
| Molecular Weight | 634.64 g/mol |
| Exact Mass | 634.21 |
| IUPAC Name | 5-[1,1-difluoro-3-[4-[2-fluoro-4-[2-fluoro-4-(4-pentylphenyl)phenyl]phenyl]phenyl]prop-2-enoxy]-1,2,3-trifluorobenzene |
| SMILES | CCCCCc1ccc(-c2ccc(-c3ccc(-c4ccc(C=CC(F)(F)Oc5cc(F)c(F)c(F)c5)cc4)c(F)c3)c(F)c2)cc1 |
| InChI | InChI=1S/C38H29F7O/c1-2-3-4-5-24-6-10-26(11-7-24)28-14-16-32(33(39)20-28)29-15-17-31(34(40)21-29)27-12-8-25(9-13-27)18-19-38(44,45)46-30-22-35(41)37(43)36(42)23-30/h6-23H,2-5H2,1H3 |
| InChIKey | SACAXWHWFQNGHA-UHFFFAOYSA-N |
| XLogP | 11.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.64 |
| LogP ≤ 5 | 11.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|