C21H40N2O4 — CID 76662636
N-(4-propan-2-yloxybutyl)-1-(2-propan-2-yloxyhexanoyl)pyrrolidine-2-carboxamide (PubChem CID 76662636) has the molecular formula C21H40N2O4 and a molecular weight of 384.56 g/mol. Its IUPAC name is N-(4-propan-2-yloxybutyl)-1-(2-propan-2-yloxyhexanoyl)pyrrolidine-2-carboxamide.
| Compound Name | N-(4-propan-2-yloxybutyl)-1-(2-propan-2-yloxyhexanoyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 76662636 |
| Molecular Formula | C21H40N2O4 |
| Molecular Weight | 384.56 g/mol |
| Exact Mass | 384.30 |
| IUPAC Name | N-(4-propan-2-yloxybutyl)-1-(2-propan-2-yloxyhexanoyl)pyrrolidine-2-carboxamide |
| SMILES | CCCCC(OC(C)C)C(=O)N1CCCC1C(=O)NCCCCOC(C)C |
| InChI | InChI=1S/C21H40N2O4/c1-6-7-12-19(27-17(4)5)21(25)23-14-10-11-18(23)20(24)22-13-8-9-15-26-16(2)3/h16-19H,6-15H2,1-5H3,(H,22,24) |
| InChIKey | OFDNZRQOTOWTPE-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.56 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|