C27H33ClF3N7O2 — CID 76684248
(1R,2S,3R,5R)-3-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[[4-[5-chloro-6-(trifluoromethyl)-1H-benzimidazol-2-yl]butyl-propan-2-ylamino]methyl]cyclopentane-1,2-diol (PubChem CID 76684248) has the molecular formula C27H33ClF3N7O2 and a molecular weight of 580.06 g/mol. Its IUPAC name is (1R,2S,3R,5R)-3-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[[4-[5-chloro-6-(trifluoromethyl)-1H-benzimidazol-2-yl]butyl-propan-2-ylamino]methyl]cyclopentane-1,2-diol.
| Compound Name | (1R,2S,3R,5R)-3-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[[4-[5-chloro-6-(trifluoromethyl)-1H-benzimidazol-2-yl]butyl-propan-2-ylamino]methyl]cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 76684248 |
| Molecular Formula | C27H33ClF3N7O2 |
| Molecular Weight | 580.06 g/mol |
| Exact Mass | 579.23 |
| IUPAC Name | (1R,2S,3R,5R)-3-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[[4-[5-chloro-6-(trifluoromethyl)-1H-benzimidazol-2-yl]butyl-propan-2-ylamino]methyl]cyclopentane-1,2-diol |
| SMILES | CC(C)N(CCCCc1nc2cc(Cl)c(C(F)(F)F)cc2[nH]1)C[C@H]1C[C@@H](n2ccc3c(N)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C27H33ClF3N7O2/c1-14(2)37(7-4-3-5-22-35-19-10-17(27(29,30)31)18(28)11-20(19)36-22)12-15-9-21(24(40)23(15)39)38-8-6-16-25(32)33-13-34-26(16)38/h6,8,10-11,13-15,21,23-24,39-40H,3-5,7,9,12H2,1-2H3,(H,35,36)(H2,32,33,34)/t15-,21-,23-,24+/m1/s1 |
| InChIKey | LGCSABFTYYJVBW-JYTHOGFNSA-N |
| XLogP | 4.58 |
| TPSA | 129.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.06 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|