C25H20N2O2 — CID 7670497
4-[4-[2-(7-ethyl-1H-indol-3-yl)-2-oxoethoxy]phenyl]benzonitrile (PubChem CID 7670497) has the molecular formula C25H20N2O2 and a molecular weight of 380.45 g/mol. Its IUPAC name is 4-[4-[2-(7-ethyl-1H-indol-3-yl)-2-oxoethoxy]phenyl]benzonitrile.
| Compound Name | 4-[4-[2-(7-ethyl-1H-indol-3-yl)-2-oxoethoxy]phenyl]benzonitrile |
|---|---|
| PubChem CID | 7670497 |
| Molecular Formula | C25H20N2O2 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 4-[4-[2-(7-ethyl-1H-indol-3-yl)-2-oxoethoxy]phenyl]benzonitrile |
| SMILES | CCc1cccc2c(C(=O)COc3ccc(-c4ccc(C#N)cc4)cc3)c[nH]c12 |
| InChI | InChI=1S/C25H20N2O2/c1-2-18-4-3-5-22-23(15-27-25(18)22)24(28)16-29-21-12-10-20(11-13-21)19-8-6-17(14-26)7-9-19/h3-13,15,27H,2,16H2,1H3 |
| InChIKey | CFHMSRPQYOYAJL-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |