C40H38O4S2 — CID 76710130
3-[5-[5-[4-(2,2-diphenylethenyl)phenyl]-4-hexylthiophen-2-yl]-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl]-2-methylprop-2-enoic acid (PubChem CID 76710130) has the molecular formula C40H38O4S2 and a molecular weight of 646.87 g/mol. Its IUPAC name is 3-[5-[5-[4-(2,2-diphenylethenyl)phenyl]-4-hexylthiophen-2-yl]-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl]-2-methylprop-2-enoic acid.
| Compound Name | 3-[5-[5-[4-(2,2-diphenylethenyl)phenyl]-4-hexylthiophen-2-yl]-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl]-2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 76710130 |
| Molecular Formula | C40H38O4S2 |
| Molecular Weight | 646.87 g/mol |
| Exact Mass | 646.22 |
| IUPAC Name | 3-[5-[5-[4-(2,2-diphenylethenyl)phenyl]-4-hexylthiophen-2-yl]-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl]-2-methylprop-2-enoic acid |
| SMILES | CCCCCCc1cc(-c2sc(C=C(C)C(=O)O)c3c2OCCO3)sc1-c1ccc(C=C(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C40H38O4S2/c1-3-4-5-8-17-32-26-35(39-37-36(43-22-23-44-37)34(45-39)24-27(2)40(41)42)46-38(32)31-20-18-28(19-21-31)25-33(29-13-9-6-10-14-29)30-15-11-7-12-16-30/h6-7,9-16,18-21,24-26H,3-5,8,17,22-23H2,1-2H3,(H,41,42) |
| InChIKey | SPZULVPKJNFMCN-UHFFFAOYSA-N |
| XLogP | 11.11 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.87 |
| LogP ≤ 5 | 11.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|