C20H20ClN3O4 — CID 76717361
N-(2-chloroethyl)-N'-(4-cyanophenyl)-2,3-dihydroxy-N-(4-methylphenyl)butanediamide (PubChem CID 76717361) has the molecular formula C20H20ClN3O4 and a molecular weight of 401.85 g/mol. Its IUPAC name is N-(2-chloroethyl)-N'-(4-cyanophenyl)-2,3-dihydroxy-N-(4-methylphenyl)butanediamide.
| Compound Name | N-(2-chloroethyl)-N'-(4-cyanophenyl)-2,3-dihydroxy-N-(4-methylphenyl)butanediamide |
|---|---|
| PubChem CID | 76717361 |
| Molecular Formula | C20H20ClN3O4 |
| Molecular Weight | 401.85 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | N-(2-chloroethyl)-N'-(4-cyanophenyl)-2,3-dihydroxy-N-(4-methylphenyl)butanediamide |
| SMILES | Cc1ccc(N(CCCl)C(=O)C(O)C(O)C(=O)Nc2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C20H20ClN3O4/c1-13-2-8-16(9-3-13)24(11-10-21)20(28)18(26)17(25)19(27)23-15-6-4-14(12-22)5-7-15/h2-9,17-18,25-26H,10-11H2,1H3,(H,23,27) |
| InChIKey | GTOSHGYTCYWLJS-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 113.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.85 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|