C25H26ClN3O6 — CID 118495849
[(2R,3R)-3-acetyloxy-4-[N-(2-chloroethyl)-2,4-dimethylanilino]-1-(4-cyanoanilino)-1,4-dioxobutan-2-yl] acetate (PubChem CID 118495849) has the molecular formula C25H26ClN3O6 and a molecular weight of 499.95 g/mol. Its IUPAC name is [(2R,3R)-3-acetyloxy-4-[N-(2-chloroethyl)-2,4-dimethylanilino]-1-(4-cyanoanilino)-1,4-dioxobutan-2-yl] acetate.
| Compound Name | [(2R,3R)-3-acetyloxy-4-[N-(2-chloroethyl)-2,4-dimethylanilino]-1-(4-cyanoanilino)-1,4-dioxobutan-2-yl] acetate |
|---|---|
| PubChem CID | 118495849 |
| Molecular Formula | C25H26ClN3O6 |
| Molecular Weight | 499.95 g/mol |
| Exact Mass | 499.15 |
| IUPAC Name | [(2R,3R)-3-acetyloxy-4-[N-(2-chloroethyl)-2,4-dimethylanilino]-1-(4-cyanoanilino)-1,4-dioxobutan-2-yl] acetate |
| SMILES | CC(=O)O[C@@H](C(=O)Nc1ccc(C#N)cc1)[C@@H](OC(C)=O)C(=O)N(CCCl)c1ccc(C)cc1C |
| InChI | InChI=1S/C25H26ClN3O6/c1-15-5-10-21(16(2)13-15)29(12-11-26)25(33)23(35-18(4)31)22(34-17(3)30)24(32)28-20-8-6-19(14-27)7-9-20/h5-10,13,22-23H,11-12H2,1-4H3,(H,28,32)/t22-,23-/m1/s1 |
| InChIKey | MCQMFHMXSHRRCQ-DHIUTWEWSA-N |
| XLogP | 3.25 |
| TPSA | 125.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.95 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|