C27H29N3O2S — CID 76723092
tert-butyl N-[3-(1H-indol-3-yl)-1-(naphthalen-1-ylmethylamino)-1-sulfanylidenepropan-2-yl]carbamate (PubChem CID 76723092) has the molecular formula C27H29N3O2S and a molecular weight of 459.62 g/mol. Its IUPAC name is tert-butyl N-[3-(1H-indol-3-yl)-1-(naphthalen-1-ylmethylamino)-1-sulfanylidenepropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[3-(1H-indol-3-yl)-1-(naphthalen-1-ylmethylamino)-1-sulfanylidenepropan-2-yl]carbamate |
|---|---|
| PubChem CID | 76723092 |
| Molecular Formula | C27H29N3O2S |
| Molecular Weight | 459.62 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | tert-butyl N-[3-(1H-indol-3-yl)-1-(naphthalen-1-ylmethylamino)-1-sulfanylidenepropan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(Cc1c[nH]c2ccccc12)C(=S)NCc1cccc2ccccc12 |
| InChI | InChI=1S/C27H29N3O2S/c1-27(2,3)32-26(31)30-24(15-20-17-28-23-14-7-6-13-22(20)23)25(33)29-16-19-11-8-10-18-9-4-5-12-21(18)19/h4-14,17,24,28H,15-16H2,1-3H3,(H,29,33)(H,30,31) |
| InChIKey | ZPVXVILFPDWXAV-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.62 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|