C14H13NS — CID 767429
2-(benzylamino)cyclohepta-2,4,6-triene-1-thione (PubChem CID 767429) has the molecular formula C14H13NS and a molecular weight of 227.33 g/mol. Its IUPAC name is 2-(benzylamino)cyclohepta-2,4,6-triene-1-thione.
| Compound Name | 2-(benzylamino)cyclohepta-2,4,6-triene-1-thione |
|---|---|
| PubChem CID | 767429 |
| Molecular Formula | C14H13NS |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | 2-(benzylamino)cyclohepta-2,4,6-triene-1-thione |
| SMILES | S=c1cccccc1NCc1ccccc1 |
| InChI | InChI=1S/C14H13NS/c16-14-10-6-2-5-9-13(14)15-11-12-7-3-1-4-8-12/h1-10H,11H2,(H,15,16) |
| InChIKey | AFMWRWOWBIJIAH-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|