C28H34FN9O2 — CID 76745544
tert-butyl 4-[6-[(8-cyclopentyl-10-fluoro-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]pyridazin-3-yl]-2-methylpiperazine-1-carboxylate (PubChem CID 76745544) has the molecular formula C28H34FN9O2 and a molecular weight of 547.64 g/mol. Its IUPAC name is tert-butyl 4-[6-[(8-cyclopentyl-10-fluoro-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]pyridazin-3-yl]-2-methylpiperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[6-[(8-cyclopentyl-10-fluoro-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]pyridazin-3-yl]-2-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 76745544 |
| Molecular Formula | C28H34FN9O2 |
| Molecular Weight | 547.64 g/mol |
| Exact Mass | 547.28 |
| IUPAC Name | tert-butyl 4-[6-[(8-cyclopentyl-10-fluoro-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]pyridazin-3-yl]-2-methylpiperazine-1-carboxylate |
| SMILES | CC1CN(c2ccc(Nc3ncc4c5ccnc(F)c5n(C5CCCC5)c4n3)nn2)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H34FN9O2/c1-17-16-36(13-14-37(17)27(39)40-28(2,3)4)22-10-9-21(34-35-22)32-26-31-15-20-19-11-12-30-24(29)23(19)38(25(20)33-26)18-7-5-6-8-18/h9-12,15,17-18H,5-8,13-14,16H2,1-4H3,(H,31,32,33,34) |
| InChIKey | DIJXVGKDWMLLHB-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 114.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.64 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|