C12H19N4O3+ — CID 7675128
[2-[(8aS)-1,3-dioxo-2-prop-2-enyl-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazin-7-yl]-2-oxoethyl]-methylazanium (PubChem CID 7675128) has the molecular formula C12H19N4O3+ and a molecular weight of 267.31 g/mol. Its IUPAC name is [2-[(8aS)-1,3-dioxo-2-prop-2-enyl-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazin-7-yl]-2-oxoethyl]-methylazanium.
| Compound Name | [2-[(8aS)-1,3-dioxo-2-prop-2-enyl-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazin-7-yl]-2-oxoethyl]-methylazanium |
|---|---|
| PubChem CID | 7675128 |
| Molecular Formula | C12H19N4O3+ |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | [2-[(8aS)-1,3-dioxo-2-prop-2-enyl-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazin-7-yl]-2-oxoethyl]-methylazanium |
| SMILES | C=CCN1C(=O)[C@@H]2CN(C(=O)C[NH2+]C)CCN2C1=O |
| InChI | InChI=1S/C12H18N4O3/c1-3-4-16-11(18)9-8-14(10(17)7-13-2)5-6-15(9)12(16)19/h3,9,13H,1,4-8H2,2H3/p+1/t9-/m0/s1 |
| InChIKey | XEKDGWGJGASRLM-VIFPVBQESA-O |
| XLogP | -2.16 |
| TPSA | 77.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | -2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|