C16H9ClN2O3 — CID 767588
methyl 2-chloro-5-[4-(2,2-dicyanoethenyl)furan-3-yl]benzoate (PubChem CID 767588) has the molecular formula C16H9ClN2O3 and a molecular weight of 312.71 g/mol. Its IUPAC name is methyl 2-chloro-5-[4-(2,2-dicyanoethenyl)furan-3-yl]benzoate.
| Compound Name | methyl 2-chloro-5-[4-(2,2-dicyanoethenyl)furan-3-yl]benzoate |
|---|---|
| PubChem CID | 767588 |
| Molecular Formula | C16H9ClN2O3 |
| Molecular Weight | 312.71 g/mol |
| Exact Mass | 312.03 |
| IUPAC Name | methyl 2-chloro-5-[4-(2,2-dicyanoethenyl)furan-3-yl]benzoate |
| SMILES | COC(=O)c1cc(-c2cocc2C=C(C#N)C#N)ccc1Cl |
| InChI | InChI=1S/C16H9ClN2O3/c1-21-16(20)13-5-11(2-3-15(13)17)14-9-22-8-12(14)4-10(6-18)7-19/h2-5,8-9H,1H3 |
| InChIKey | NGNZDXUWKVKIMB-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 87.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.71 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|