C14H23N3O6S — CID 76763953
(2S)-2-amino-6-[[(Z)-3-[[(1R)-1-carboxy-2-methylpropyl]amino]-3-oxo-1-sulfanylprop-1-en-2-yl]amino]-6-oxohexanoic acid (PubChem CID 76763953) has the molecular formula C14H23N3O6S and a molecular weight of 361.42 g/mol. Its IUPAC name is (2S)-2-amino-6-[[(Z)-3-[[(1R)-1-carboxy-2-methylpropyl]amino]-3-oxo-1-sulfanylprop-1-en-2-yl]amino]-6-oxohexanoic acid.
| Compound Name | (2S)-2-amino-6-[[(Z)-3-[[(1R)-1-carboxy-2-methylpropyl]amino]-3-oxo-1-sulfanylprop-1-en-2-yl]amino]-6-oxohexanoic acid |
|---|---|
| PubChem CID | 76763953 |
| Molecular Formula | C14H23N3O6S |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | (2S)-2-amino-6-[[(Z)-3-[[(1R)-1-carboxy-2-methylpropyl]amino]-3-oxo-1-sulfanylprop-1-en-2-yl]amino]-6-oxohexanoic acid |
| SMILES | CC(C)[C@@H](NC(=O)/C(=C/S)NC(=O)CCC[C@H](N)C(=O)O)C(=O)O |
| InChI | InChI=1S/C14H23N3O6S/c1-7(2)11(14(22)23)17-12(19)9(6-24)16-10(18)5-3-4-8(15)13(20)21/h6-8,11,24H,3-5,15H2,1-2H3,(H,16,18)(H,17,19)(H,20,21)(H,22,23)/b9-6-/t8-,11+/m0/s1 |
| InChIKey | ZDISTFOJLIYYPQ-CPXYCWQVSA-N |
| XLogP | -0.32 |
| TPSA | 158.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|